C15H20F3NO2 — CID 135187761
(4aS,8aR)-2-acetyl-5,5,8a-trimethyl-7-(trifluoromethyl)-1,3,4,4a-tetrahydroisoquinolin-6-one (PubChem CID 135187761) has the molecular formula C15H20F3NO2 and a molecular weight of 303.32 g/mol. Its IUPAC name is (4aS,8aR)-2-acetyl-5,5,8a-trimethyl-7-(trifluoromethyl)-1,3,4,4a-tetrahydroisoquinolin-6-one.
| Compound Name | (4aS,8aR)-2-acetyl-5,5,8a-trimethyl-7-(trifluoromethyl)-1,3,4,4a-tetrahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 135187761 |
| Molecular Formula | C15H20F3NO2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | (4aS,8aR)-2-acetyl-5,5,8a-trimethyl-7-(trifluoromethyl)-1,3,4,4a-tetrahydroisoquinolin-6-one |
| SMILES | CC(=O)N1CC[C@@H]2C(C)(C)C(=O)C(C(F)(F)F)=C[C@@]2(C)C1 |
| InChI | InChI=1S/C15H20F3NO2/c1-9(20)19-6-5-11-13(2,3)12(21)10(15(16,17)18)7-14(11,4)8-19/h7,11H,5-6,8H2,1-4H3/t11-,14+/m1/s1 |
| InChIKey | OUEZROGWCMVHRP-RISCZKNCSA-N |
| XLogP | 2.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |