About 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole
1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole (PubChem CID 135187829) has the molecular formula C17H15F2N3
and a molecular weight of 299.32 g/mol. Its IUPAC name is 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole |
| PubChem CID | 135187829 |
| Molecular Formula | C17H15F2N3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole |
| SMILES | CCc1cc(-c2cc3cc(F)c(F)cc3n2C2CC2)cnn1 |
| InChI | InChI=1S/C17H15F2N3/c1-2-12-5-11(9-20-21-12)16-7-10-6-14(18)15(19)8-17(10)22(16)13-3-4-13/h5-9,13H,2-4H2,1H3 |
| InChIKey | JQPAILLCTKLELI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole?
The IUPAC name of 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole (CID 135187829) is 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole.
What is the SMILES notation for 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole?
The canonical SMILES for 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole is CCc1cc(-c2cc3cc(F)c(F)cc3n2C2CC2)cnn1.
What is the InChIKey of 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole?
The InChIKey is JQPAILLCTKLELI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N3/c1-2-12-5-11(9-20-21-12)16-7-10-6-14(18)15(19)8-17(10)22(16)13-3-4-13/h5-9,13H,2-4H2,1H3.
What are the key properties of 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole?
1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole has a molecular weight of 299.32 g/mol, XLogP of 4.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(6-ethylpyridazin-4-yl)-5,6-difluoroindole is sourced from PubChem (CID 135187829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).