About 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one
9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one (PubChem CID 135188409) has the molecular formula C26H22N4O2
and a molecular weight of 422.49 g/mol. Its IUPAC name is 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one.
Molecular Properties
| Compound Name | 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one |
| PubChem CID | 135188409 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one |
| SMILES | CCOc1ccc2c3ccncc3n(CCn3c4c[nH]ccc4c4ccc(=O)cc43)c2c1 |
| InChI | InChI=1S/C26H22N4O2/c1-2-32-18-4-6-20-22-8-10-28-16-26(22)30(24(20)14-18)12-11-29-23-13-17(31)3-5-19(23)21-7-9-27-15-25(21)29/h3-10,13-16,27H,2,11-12H2,1H3 |
| InChIKey | XRIFLUCUUIGKTC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one?
The IUPAC name of 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one (CID 135188409) is 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one.
What is the SMILES notation for 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one?
The canonical SMILES for 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one is CCOc1ccc2c3ccncc3n(CCn3c4c[nH]ccc4c4ccc(=O)cc43)c2c1.
What is the InChIKey of 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one?
The InChIKey is XRIFLUCUUIGKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H22N4O2/c1-2-32-18-4-6-20-22-8-10-28-16-26(22)30(24(20)14-18)12-11-29-23-13-17(31)3-5-19(23)21-7-9-27-15-25(21)29/h3-10,13-16,27H,2,11-12H2,1H3.
What are the key properties of 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one?
9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one has a molecular weight of 422.49 g/mol, XLogP of 5.08, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[2-(7-ethoxypyrido[3,4-b]indol-9-yl)ethyl]-2H-pyrido[3,4-b]indol-7-one is sourced from PubChem (CID 135188409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).