About N,N'-bis(ethenyl)-N'-methylmethanediamine
N,N'-bis(ethenyl)-N'-methylmethanediamine (PubChem CID 135188426) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is N,N'-bis(ethenyl)-N'-methylmethanediamine.
Molecular Properties
| Compound Name | N,N'-bis(ethenyl)-N'-methylmethanediamine |
| PubChem CID | 135188426 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | N,N'-bis(ethenyl)-N'-methylmethanediamine |
| SMILES | C=CNCN(C)C=C |
| InChI | InChI=1S/C6H12N2/c1-4-7-6-8(3)5-2/h4-5,7H,1-2,6H2,3H3 |
| InChIKey | CVZFAYCYTMJJJW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N,N'-bis(ethenyl)-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-bis(ethenyl)-N'-methylmethanediamine?
The IUPAC name of N,N'-bis(ethenyl)-N'-methylmethanediamine (CID 135188426) is N,N'-bis(ethenyl)-N'-methylmethanediamine.
What is the SMILES notation for N,N'-bis(ethenyl)-N'-methylmethanediamine?
The canonical SMILES for N,N'-bis(ethenyl)-N'-methylmethanediamine is C=CNCN(C)C=C.
What is the InChIKey of N,N'-bis(ethenyl)-N'-methylmethanediamine?
The InChIKey is CVZFAYCYTMJJJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2/c1-4-7-6-8(3)5-2/h4-5,7H,1-2,6H2,3H3.
What are the key properties of N,N'-bis(ethenyl)-N'-methylmethanediamine?
N,N'-bis(ethenyl)-N'-methylmethanediamine has a molecular weight of 112.18 g/mol, XLogP of 0.75, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-bis(ethenyl)-N'-methylmethanediamine is sourced from PubChem (CID 135188426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).