C32H42FN7O9 — CID 135189279
(2S)-2-[3-[(1S)-1-carboxy-5-[1-[4-[4-(3-fluoropropyl)triazol-1-yl]anilino]ethenylamino]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid (PubChem CID 135189279) has the molecular formula C32H42FN7O9 and a molecular weight of 687.73 g/mol. Its IUPAC name is (2S)-2-[3-[(1S)-1-carboxy-5-[1-[4-[4-(3-fluoropropyl)triazol-1-yl]anilino]ethenylamino]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid.
| Compound Name | (2S)-2-[3-[(1S)-1-carboxy-5-[1-[4-[4-(3-fluoropropyl)triazol-1-yl]anilino]ethenylamino]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
|---|---|
| PubChem CID | 135189279 |
| Molecular Formula | C32H42FN7O9 |
| Molecular Weight | 687.73 g/mol |
| Exact Mass | 687.30 |
| IUPAC Name | (2S)-2-[3-[(1S)-1-carboxy-5-[1-[4-[4-(3-fluoropropyl)triazol-1-yl]anilino]ethenylamino]pentyl]-5,5-diethyl-2,4,6-trioxo-1,3-diazinan-1-yl]pentanedioic acid |
| SMILES | C=C(NCCCC[C@@H](C(=O)O)N1C(=O)N([C@@H](CCC(=O)O)C(=O)O)C(=O)C(CC)(CC)C1=O)Nc1ccc(-n2cc(CCCF)nn2)cc1 |
| InChI | InChI=1S/C32H42FN7O9/c1-4-32(5-2)29(47)39(31(49)40(30(32)48)25(28(45)46)15-16-26(41)42)24(27(43)44)10-6-7-18-34-20(3)35-21-11-13-23(14-12-21)38-19-22(36-37-38)9-8-17-33/h11-14,19,24-25,34-35H,3-10,15-18H2,1-2H3,(H,41,42)(H,43,44)(H,45,46)/t24-,25-/m0/s1 |
| InChIKey | XAXKPRNPGBZYHV-DQEYMECFSA-N |
| XLogP | 3.18 |
| TPSA | 224.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|