C29H31FO4 — CID 135189423
(2S,3R,4E,6E)-3-cyclopropyl-4-ethenyl-6-[[(1R)-5-(2-fluoro-5-hydroxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2-methylocta-4,6-dienoic acid (PubChem CID 135189423) has the molecular formula C29H31FO4 and a molecular weight of 462.56 g/mol. Its IUPAC name is (2S,3R,4E,6E)-3-cyclopropyl-4-ethenyl-6-[[(1R)-5-(2-fluoro-5-hydroxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2-methylocta-4,6-dienoic acid.
| Compound Name | (2S,3R,4E,6E)-3-cyclopropyl-4-ethenyl-6-[[(1R)-5-(2-fluoro-5-hydroxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2-methylocta-4,6-dienoic acid |
|---|---|
| PubChem CID | 135189423 |
| Molecular Formula | C29H31FO4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.22 |
| IUPAC Name | (2S,3R,4E,6E)-3-cyclopropyl-4-ethenyl-6-[[(1R)-5-(2-fluoro-5-hydroxyphenyl)-2,3-dihydro-1H-inden-1-yl]oxy]-2-methylocta-4,6-dienoic acid |
| SMILES | C=C/C(=C\C(=C/C)O[C@@H]1CCc2cc(-c3cc(O)ccc3F)ccc21)[C@H](C1CC1)[C@H](C)C(=O)O |
| InChI | InChI=1S/C29H31FO4/c1-4-18(28(19-6-7-19)17(3)29(32)33)15-23(5-2)34-27-13-9-20-14-21(8-11-24(20)27)25-16-22(31)10-12-26(25)30/h4-5,8,10-12,14-17,19,27-28,31H,1,6-7,9,13H2,2-3H3,(H,32,33)/b18-15+,23-5+/t17-,27+,28+/m0/s1 |
| InChIKey | HNFZBSLSGZAUDO-ZPJIELTCSA-N |
| XLogP | 6.97 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|