About (5S)-5-amino-2,7-dioxooctanamide
(5S)-5-amino-2,7-dioxooctanamide (PubChem CID 135189804) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is (5S)-5-amino-2,7-dioxooctanamide.
Molecular Properties
| Compound Name | (5S)-5-amino-2,7-dioxooctanamide |
| PubChem CID | 135189804 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (5S)-5-amino-2,7-dioxooctanamide |
| SMILES | CC(=O)C[C@@H](N)CCC(=O)C(N)=O |
| InChI | InChI=1S/C8H14N2O3/c1-5(11)4-6(9)2-3-7(12)8(10)13/h6H,2-4,9H2,1H3,(H2,10,13)/t6-/m0/s1 |
| InChIKey | OCXVRRXGLWXCRM-LURJTMIESA-N |
| XLogP | -0.87 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-amino-2,7-dioxooctanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-amino-2,7-dioxooctanamide?
The IUPAC name of (5S)-5-amino-2,7-dioxooctanamide (CID 135189804) is (5S)-5-amino-2,7-dioxooctanamide.
What is the SMILES notation for (5S)-5-amino-2,7-dioxooctanamide?
The canonical SMILES for (5S)-5-amino-2,7-dioxooctanamide is CC(=O)C[C@@H](N)CCC(=O)C(N)=O.
What is the InChIKey of (5S)-5-amino-2,7-dioxooctanamide?
The InChIKey is OCXVRRXGLWXCRM-LURJTMIESA-N. The full InChI is InChI=1S/C8H14N2O3/c1-5(11)4-6(9)2-3-7(12)8(10)13/h6H,2-4,9H2,1H3,(H2,10,13)/t6-/m0/s1.
What are the key properties of (5S)-5-amino-2,7-dioxooctanamide?
(5S)-5-amino-2,7-dioxooctanamide has a molecular weight of 186.21 g/mol, XLogP of -0.87, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-amino-2,7-dioxooctanamide is sourced from PubChem (CID 135189804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).