C11H20N4O4S — CID 135189846
(2S,5Z)-5-(carbamothioylhydrazinylidene)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (PubChem CID 135189846) has the molecular formula C11H20N4O4S and a molecular weight of 304.37 g/mol. Its IUPAC name is (2S,5Z)-5-(carbamothioylhydrazinylidene)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid.
| Compound Name | (2S,5Z)-5-(carbamothioylhydrazinylidene)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| PubChem CID | 135189846 |
| Molecular Formula | C11H20N4O4S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | (2S,5Z)-5-(carbamothioylhydrazinylidene)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC/C=N\NC(N)=S)C(=O)O |
| InChI | InChI=1S/C11H20N4O4S/c1-11(2,3)19-10(18)14-7(8(16)17)5-4-6-13-15-9(12)20/h6-7H,4-5H2,1-3H3,(H,14,18)(H,16,17)(H3,12,15,20)/b13-6-/t7-/m0/s1 |
| InChIKey | MVNDFVUVGHGFBK-FYZKPRDOSA-N |
| XLogP | 0.56 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|