C18H25ClN2O — CID 135190163
2-[[[(E,3E)-5-chloro-3-ethylidenehept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline (PubChem CID 135190163) has the molecular formula C18H25ClN2O and a molecular weight of 320.86 g/mol. Its IUPAC name is 2-[[[(E,3E)-5-chloro-3-ethylidenehept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline.
| Compound Name | 2-[[[(E,3E)-5-chloro-3-ethylidenehept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 135190163 |
| Molecular Formula | C18H25ClN2O |
| Molecular Weight | 320.86 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 2-[[[(E,3E)-5-chloro-3-ethylidenehept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline |
| SMILES | C/C=C(\C=C(\Cl)CC)C(C)=NOCc1c(C)cccc1NC |
| InChI | InChI=1S/C18H25ClN2O/c1-6-15(11-16(19)7-2)14(4)21-22-12-17-13(3)9-8-10-18(17)20-5/h6,8-11,20H,7,12H2,1-5H3/b15-6+,16-11+,21-14? |
| InChIKey | OBXUHUSNUOUZSX-FSGNZHAGSA-N |
| XLogP | 5.41 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.86 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|