C11H18N2 — CID 135190178
1-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-1-methylhydrazine (PubChem CID 135190178) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 1-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-1-methylhydrazine.
| Compound Name | 1-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-1-methylhydrazine |
|---|---|
| PubChem CID | 135190178 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 1-[(2E,4Z)-6-cyclopropylhepta-2,4,6-trien-2-yl]-1-methylhydrazine |
| SMILES | C=C(/C=C\C=C(/C)N(C)N)C1CC1 |
| InChI | InChI=1S/C11H18N2/c1-9(11-7-8-11)5-4-6-10(2)13(3)12/h4-6,11H,1,7-8,12H2,2-3H3/b5-4-,10-6+ |
| InChIKey | QPKGXLLOLIIMGB-VWJYOPCBSA-N |
| XLogP | 2.22 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|