About (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine
(3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine (PubChem CID 135190182) has the molecular formula C11H14F3N
and a molecular weight of 217.23 g/mol. Its IUPAC name is (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine.
Molecular Properties
| Compound Name | (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine |
| PubChem CID | 135190182 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine |
| SMILES | C=C/C(=C\C(=C/C)\C(C)=N\C)C(F)(F)F |
| InChI | InChI=1S/C11H14F3N/c1-5-9(8(3)15-4)7-10(6-2)11(12,13)14/h5-7H,2H2,1,3-4H3/b9-5+,10-7+,15-8+ |
| InChIKey | LMRUULBBBYQECM-KOIHINQFSA-N |
| XLogP | 3.70 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine?
The IUPAC name of (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine (CID 135190182) is (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine.
What is the SMILES notation for (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine?
The canonical SMILES for (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine is C=C/C(=C\C(=C/C)\C(C)=N\C)C(F)(F)F.
What is the InChIKey of (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine?
The InChIKey is LMRUULBBBYQECM-KOIHINQFSA-N. The full InChI is InChI=1S/C11H14F3N/c1-5-9(8(3)15-4)7-10(6-2)11(12,13)14/h5-7H,2H2,1,3-4H3/b9-5+,10-7+,15-8+.
What are the key properties of (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine?
(3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine has a molecular weight of 217.23 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3-ethylidene-N-methyl-5-(trifluoromethyl)hepta-4,6-dien-2-imine is sourced from PubChem (CID 135190182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).