C11H20N2O — CID 135190198
[(2E,4E)-4-(methoxymethyl)-5,6-dimethylhepta-2,4,6-trien-3-yl]hydrazine (PubChem CID 135190198) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is [(2E,4E)-4-(methoxymethyl)-5,6-dimethylhepta-2,4,6-trien-3-yl]hydrazine.
| Compound Name | [(2E,4E)-4-(methoxymethyl)-5,6-dimethylhepta-2,4,6-trien-3-yl]hydrazine |
|---|---|
| PubChem CID | 135190198 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | [(2E,4E)-4-(methoxymethyl)-5,6-dimethylhepta-2,4,6-trien-3-yl]hydrazine |
| SMILES | C=C(C)/C(C)=C(COC)\C(=C/C)NN |
| InChI | InChI=1S/C11H20N2O/c1-6-11(13-12)10(7-14-5)9(4)8(2)3/h6,13H,2,7,12H2,1,3-5H3/b10-9-,11-6+ |
| InChIKey | HCFLTESPWPMLHM-AOXGIJKRSA-N |
| XLogP | 1.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|