C18H17F6N3O — CID 135190277
N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanimine (PubChem CID 135190277) has the molecular formula C18H17F6N3O and a molecular weight of 405.34 g/mol. Its IUPAC name is N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanimine.
| Compound Name | N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanimine |
|---|---|
| PubChem CID | 135190277 |
| Molecular Formula | C18H17F6N3O |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | N-[[2-[amino(methyl)amino]-6-methylphenyl]methoxy]-2,2,2-trifluoro-1-[3-(trifluoromethyl)phenyl]ethanimine |
| SMILES | Cc1cccc(N(C)N)c1CON=C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C18H17F6N3O/c1-11-5-3-8-15(27(2)25)14(11)10-28-26-16(18(22,23)24)12-6-4-7-13(9-12)17(19,20)21/h3-9H,10,25H2,1-2H3 |
| InChIKey | HEGRUSXMTNUPFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|