C12H17FO2 — CID 135190287
(3E,5Z)-7-(1-fluoropropoxy)-3-methylocta-3,5,7-trien-2-one (PubChem CID 135190287) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is (3E,5Z)-7-(1-fluoropropoxy)-3-methylocta-3,5,7-trien-2-one.
| Compound Name | (3E,5Z)-7-(1-fluoropropoxy)-3-methylocta-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 135190287 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (3E,5Z)-7-(1-fluoropropoxy)-3-methylocta-3,5,7-trien-2-one |
| SMILES | C=C(/C=C\C=C(/C)C(C)=O)OC(F)CC |
| InChI | InChI=1S/C12H17FO2/c1-5-12(13)15-10(3)8-6-7-9(2)11(4)14/h6-8,12H,3,5H2,1-2,4H3/b8-6-,9-7+ |
| InChIKey | JFBQAYLIVVWVPQ-MKKAVFGOSA-N |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|