About 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine
1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine (PubChem CID 135190369) has the molecular formula C13H20F3N
and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine.
Molecular Properties
| Compound Name | 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine |
| PubChem CID | 135190369 |
| Molecular Formula | C13H20F3N |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine |
| SMILES | CCC(C)C1=CCC(C(C)N)C=C1C(F)(F)F |
| InChI | InChI=1S/C13H20F3N/c1-4-8(2)11-6-5-10(9(3)17)7-12(11)13(14,15)16/h6-10H,4-5,17H2,1-3H3 |
| InChIKey | ARABULZEIMYDOB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine?
The IUPAC name of 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine (CID 135190369) is 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine.
What is the SMILES notation for 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine?
The canonical SMILES for 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine is CCC(C)C1=CCC(C(C)N)C=C1C(F)(F)F.
What is the InChIKey of 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine?
The InChIKey is ARABULZEIMYDOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N/c1-4-8(2)11-6-5-10(9(3)17)7-12(11)13(14,15)16/h6-10H,4-5,17H2,1-3H3.
What are the key properties of 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine?
1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine has a molecular weight of 247.30 g/mol, XLogP of 3.81, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-butan-2-yl-3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]ethanamine is sourced from PubChem (CID 135190369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).