C23H32N2O2 — CID 135190421
2-[[[(E,3E)-3-ethylidene-5-pent-2-ynoxyhept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline (PubChem CID 135190421) has the molecular formula C23H32N2O2 and a molecular weight of 368.52 g/mol. Its IUPAC name is 2-[[[(E,3E)-3-ethylidene-5-pent-2-ynoxyhept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline.
| Compound Name | 2-[[[(E,3E)-3-ethylidene-5-pent-2-ynoxyhept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline |
|---|---|
| PubChem CID | 135190421 |
| Molecular Formula | C23H32N2O2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | 2-[[[(E,3E)-3-ethylidene-5-pent-2-ynoxyhept-4-en-2-ylidene]amino]oxymethyl]-N,3-dimethylaniline |
| SMILES | C/C=C(\C=C(/CC)OCC#CCC)C(C)=NOCc1c(C)cccc1NC |
| InChI | InChI=1S/C23H32N2O2/c1-7-10-11-15-26-21(9-3)16-20(8-2)19(5)25-27-17-22-18(4)13-12-14-23(22)24-6/h8,12-14,16,24H,7,9,15,17H2,1-6H3/b20-8+,21-16+,25-19? |
| InChIKey | NHCOVTVZOPDIOR-RJXGUKFTSA-N |
| XLogP | 5.60 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|