About (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide
(2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide (PubChem CID 135190435) has the molecular formula C17H29NO2
and a molecular weight of 279.42 g/mol. Its IUPAC name is (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide.
Molecular Properties
| Compound Name | (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide |
| PubChem CID | 135190435 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide |
| SMILES | C=C(C)CCCCC(C)/C(=C\C=C/C)C(=O)N(C)OC |
| InChI | InChI=1S/C17H29NO2/c1-7-8-13-16(17(19)18(5)20-6)15(4)12-10-9-11-14(2)3/h7-8,13,15H,2,9-12H2,1,3-6H3/b8-7-,16-13+ |
| InChIKey | DGXAJWKVYHYMTJ-AKLMFZFWSA-N |
| XLogP | 4.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide?
The IUPAC name of (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide (CID 135190435) is (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide.
What is the SMILES notation for (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide?
The canonical SMILES for (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide is C=C(C)CCCCC(C)/C(=C\C=C/C)C(=O)N(C)OC.
What is the InChIKey of (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide?
The InChIKey is DGXAJWKVYHYMTJ-AKLMFZFWSA-N. The full InChI is InChI=1S/C17H29NO2/c1-7-8-13-16(17(19)18(5)20-6)15(4)12-10-9-11-14(2)3/h7-8,13,15H,2,9-12H2,1,3-6H3/b8-7-,16-13+.
What are the key properties of (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide?
(2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide has a molecular weight of 279.42 g/mol, XLogP of 4.28, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-[(Z)-but-2-enylidene]-N-methoxy-N,3,8-trimethylnon-8-enamide is sourced from PubChem (CID 135190435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).