C17H20F3N — CID 135190461
1-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)cyclohepta-1,6-dien-1-yl]ethanimine (PubChem CID 135190461) has the molecular formula C17H20F3N and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)cyclohepta-1,6-dien-1-yl]ethanimine.
| Compound Name | 1-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)cyclohepta-1,6-dien-1-yl]ethanimine |
|---|---|
| PubChem CID | 135190461 |
| Molecular Formula | C17H20F3N |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 1-[5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-(trifluoromethyl)cyclohepta-1,6-dien-1-yl]ethanimine |
| SMILES | [H]/N=C(\C)C1=CCCC(C(/C=C\C)=C/C=C)C(C(F)(F)F)=C1 |
| InChI | InChI=1S/C17H20F3N/c1-4-7-13(8-5-2)15-10-6-9-14(12(3)21)11-16(15)17(18,19)20/h4-5,7-9,11,15,21H,1,6,10H2,2-3H3/b8-5-,13-7+,21-12+ |
| InChIKey | MMWNZGAUIJNFIL-WQCUDDBZSA-N |
| XLogP | 5.54 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|