C17H21F2N — CID 135190781
3-cyclohexa-1,5-dien-1-yl-4-(5,6-difluorocyclohexa-1,5-dien-1-yl)pentan-2-imine (PubChem CID 135190781) has the molecular formula C17H21F2N and a molecular weight of 277.36 g/mol. Its IUPAC name is 3-cyclohexa-1,5-dien-1-yl-4-(5,6-difluorocyclohexa-1,5-dien-1-yl)pentan-2-imine.
| Compound Name | 3-cyclohexa-1,5-dien-1-yl-4-(5,6-difluorocyclohexa-1,5-dien-1-yl)pentan-2-imine |
|---|---|
| PubChem CID | 135190781 |
| Molecular Formula | C17H21F2N |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 3-cyclohexa-1,5-dien-1-yl-4-(5,6-difluorocyclohexa-1,5-dien-1-yl)pentan-2-imine |
| SMILES | [H]/N=C(\C)C(C1=CCCC=C1)C(C)C1=CCCC(F)=C1F |
| InChI | InChI=1S/C17H21F2N/c1-11(14-9-6-10-15(18)17(14)19)16(12(2)20)13-7-4-3-5-8-13/h4,7-9,11,16,20H,3,5-6,10H2,1-2H3/b20-12+ |
| InChIKey | QQKAXLJKAAXLTD-UDWIEESQSA-N |
| XLogP | 5.43 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|