C8H12F3NS — CID 135190971
(3aR,6aS)-2-(trifluoromethylsulfanyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole (PubChem CID 135190971) has the molecular formula C8H12F3NS and a molecular weight of 211.25 g/mol. Its IUPAC name is (3aR,6aS)-2-(trifluoromethylsulfanyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole.
| Compound Name | (3aR,6aS)-2-(trifluoromethylsulfanyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 135190971 |
| Molecular Formula | C8H12F3NS |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (3aR,6aS)-2-(trifluoromethylsulfanyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole |
| SMILES | FC(F)(F)SN1C[C@H]2CCC[C@H]2C1 |
| InChI | InChI=1S/C8H12F3NS/c9-8(10,11)13-12-4-6-2-1-3-7(6)5-12/h6-7H,1-5H2/t6-,7+ |
| InChIKey | OJCLNKNVSHQRMO-KNVOCYPGSA-N |
| XLogP | 2.89 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|