About 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine
6-methanimidoylcyclohexa-1,5-diene-1,3-diamine (PubChem CID 135191478) has the molecular formula C7H11N3
and a molecular weight of 137.19 g/mol. Its IUPAC name is 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine.
Molecular Properties
| Compound Name | 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine |
| PubChem CID | 135191478 |
| Molecular Formula | C7H11N3 |
| Molecular Weight | 137.19 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine |
| SMILES | [H]/N=C/C1=CCC(N)C=C1N |
| InChI | InChI=1S/C7H11N3/c8-4-5-1-2-6(9)3-7(5)10/h1,3-4,6,8H,2,9-10H2/b8-4+ |
| InChIKey | MPACMBKNXMRBQJ-XBXARRHUSA-N |
| XLogP | 0.14 |
| TPSA | 75.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.19 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine?
The IUPAC name of 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine (CID 135191478) is 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine.
What is the SMILES notation for 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine?
The canonical SMILES for 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine is [H]/N=C/C1=CCC(N)C=C1N.
What is the InChIKey of 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine?
The InChIKey is MPACMBKNXMRBQJ-XBXARRHUSA-N. The full InChI is InChI=1S/C7H11N3/c8-4-5-1-2-6(9)3-7(5)10/h1,3-4,6,8H,2,9-10H2/b8-4+.
What are the key properties of 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine?
6-methanimidoylcyclohexa-1,5-diene-1,3-diamine has a molecular weight of 137.19 g/mol, XLogP of 0.14, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methanimidoylcyclohexa-1,5-diene-1,3-diamine is sourced from PubChem (CID 135191478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).