C8H9Cl2F — CID 135192472
(3Z,5E)-2,5-dichloro-7-fluoro-6-methylhepta-1,3,5-triene (PubChem CID 135192472) has the molecular formula C8H9Cl2F and a molecular weight of 195.06 g/mol. Its IUPAC name is (3Z,5E)-2,5-dichloro-7-fluoro-6-methylhepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2,5-dichloro-7-fluoro-6-methylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 135192472 |
| Molecular Formula | C8H9Cl2F |
| Molecular Weight | 195.06 g/mol |
| Exact Mass | 194.01 |
| IUPAC Name | (3Z,5E)-2,5-dichloro-7-fluoro-6-methylhepta-1,3,5-triene |
| SMILES | C=C(Cl)/C=C\C(Cl)=C(\C)CF |
| InChI | InChI=1S/C8H9Cl2F/c1-6(5-11)8(10)4-3-7(2)9/h3-4H,2,5H2,1H3/b4-3-,8-6+ |
| InChIKey | HLMPGYNBERNXHA-OONGGIDMSA-N |
| XLogP | 3.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.06 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|