C22H18F5NO3 — CID 135192662
8-[(E)-hex-1-enyl]-2-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one (PubChem CID 135192662) has the molecular formula C22H18F5NO3 and a molecular weight of 439.38 g/mol. Its IUPAC name is 8-[(E)-hex-1-enyl]-2-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one.
| Compound Name | 8-[(E)-hex-1-enyl]-2-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 135192662 |
| Molecular Formula | C22H18F5NO3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | 8-[(E)-hex-1-enyl]-2-methyl-4-(2,3,4,5,6-pentafluorobenzoyl)-1,4-benzoxazin-3-one |
| SMILES | CCCC/C=C/c1cccc2c1OC(C)C(=O)N2C(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H18F5NO3/c1-3-4-5-6-8-12-9-7-10-13-20(12)31-11(2)21(29)28(13)22(30)14-15(23)17(25)19(27)18(26)16(14)24/h6-11H,3-5H2,1-2H3/b8-6+ |
| InChIKey | ZZHWQGDKPPSRLO-SOFGYWHQSA-N |
| XLogP | 5.54 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|