C21H21ClF2IN5O2 — CID 135192931
5-[3-[(3R)-3-(2-chloro-4-fluorophenyl)-3-iodopyrrolidin-1-yl]-5-(2-fluoroethoxymethyl)-1,2,4-triazol-4-yl]-2-methoxypyridine (PubChem CID 135192931) has the molecular formula C21H21ClF2IN5O2 and a molecular weight of 575.79 g/mol. Its IUPAC name is 5-[3-[(3R)-3-(2-chloro-4-fluorophenyl)-3-iodopyrrolidin-1-yl]-5-(2-fluoroethoxymethyl)-1,2,4-triazol-4-yl]-2-methoxypyridine.
| Compound Name | 5-[3-[(3R)-3-(2-chloro-4-fluorophenyl)-3-iodopyrrolidin-1-yl]-5-(2-fluoroethoxymethyl)-1,2,4-triazol-4-yl]-2-methoxypyridine |
|---|---|
| PubChem CID | 135192931 |
| Molecular Formula | C21H21ClF2IN5O2 |
| Molecular Weight | 575.79 g/mol |
| Exact Mass | 575.04 |
| IUPAC Name | 5-[3-[(3R)-3-(2-chloro-4-fluorophenyl)-3-iodopyrrolidin-1-yl]-5-(2-fluoroethoxymethyl)-1,2,4-triazol-4-yl]-2-methoxypyridine |
| SMILES | COc1ccc(-n2c(COCCF)nnc2N2CC[C@@](I)(c3ccc(F)cc3Cl)C2)cn1 |
| InChI | InChI=1S/C21H21ClF2IN5O2/c1-31-19-5-3-15(11-26-19)30-18(12-32-9-7-23)27-28-20(30)29-8-6-21(25,13-29)16-4-2-14(24)10-17(16)22/h2-5,10-11H,6-9,12-13H2,1H3/t21-/m0/s1 |
| InChIKey | WNEARLKQVHMLSX-NRFANRHFSA-N |
| XLogP | 4.49 |
| TPSA | 65.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.79 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|