C54H41N3O2P2 — CID 135193032
9-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]carbazole (PubChem CID 135193032) has the molecular formula C54H41N3O2P2 and a molecular weight of 825.89 g/mol. Its IUPAC name is 9-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]carbazole.
| Compound Name | 9-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]carbazole |
|---|---|
| PubChem CID | 135193032 |
| Molecular Formula | C54H41N3O2P2 |
| Molecular Weight | 825.89 g/mol |
| Exact Mass | 825.27 |
| IUPAC Name | 9-[3-[[2-[[2-[[3-(2-methylpyrimidin-5-yl)phenyl]-phenylphosphoryl]phenyl]methyl]phenyl]-phenylphosphoryl]phenyl]carbazole |
| SMILES | Cc1ncc(-c2cccc(P(=O)(c3ccccc3)c3ccccc3Cc3ccccc3P(=O)(c3ccccc3)c3cccc(-n4c5ccccc5c5ccccc54)c3)c2)cn1 |
| InChI | InChI=1S/C54H41N3O2P2/c1-39-55-37-43(38-56-39)40-20-16-26-47(35-40)60(58,45-22-4-2-5-23-45)53-32-14-8-18-41(53)34-42-19-9-15-33-54(42)61(59,46-24-6-3-7-25-46)48-27-17-21-44(36-48)57-51-30-12-10-28-49(51)50-29-11-13-31-52(50)57/h2-33,35-38H,34H2,1H3 |
| InChIKey | XTJLCIZYDVKEIX-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 64.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.89 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|