C15H12O4 — CID 135193034
5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-2-benzofuran-1,3-dione (PubChem CID 135193034) has the molecular formula C15H12O4 and a molecular weight of 256.26 g/mol. Its IUPAC name is 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-2-benzofuran-1,3-dione.
| Compound Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 135193034 |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-2-benzofuran-1,3-dione |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C15H12O4/c1-3-5-6-10(4-2)18-11-7-8-12-13(9-11)15(17)19-14(12)16/h3-9H,2H2,1H3/b5-3-,10-6+ |
| InChIKey | ZOLOMFBDMMGIPN-UTMABKKZSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|