C12H13NO — CID 135193048
3,5a,9a,10-tetrahydro-2H-phenoxazine (PubChem CID 135193048) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 3,5a,9a,10-tetrahydro-2H-phenoxazine.
| Compound Name | 3,5a,9a,10-tetrahydro-2H-phenoxazine |
|---|---|
| PubChem CID | 135193048 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 3,5a,9a,10-tetrahydro-2H-phenoxazine |
| SMILES | C1=CC2NC3=CCCC=C3OC2C=C1 |
| InChI | InChI=1S/C12H13NO/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1,3,5-9,11,13H,2,4H2 |
| InChIKey | CFPWELBPYIDZDM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |