C13H12F3NO — CID 135193066
8-(trifluoromethyl)-3,5a,9a,10-tetrahydro-2H-phenoxazine (PubChem CID 135193066) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 8-(trifluoromethyl)-3,5a,9a,10-tetrahydro-2H-phenoxazine.
| Compound Name | 8-(trifluoromethyl)-3,5a,9a,10-tetrahydro-2H-phenoxazine |
|---|---|
| PubChem CID | 135193066 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 8-(trifluoromethyl)-3,5a,9a,10-tetrahydro-2H-phenoxazine |
| SMILES | FC(F)(F)C1=CC2NC3=CCCC=C3OC2C=C1 |
| InChI | InChI=1S/C13H12F3NO/c14-13(15,16)8-5-6-12-10(7-8)17-9-3-1-2-4-11(9)18-12/h3-7,10,12,17H,1-2H2 |
| InChIKey | BTSBYTUQJMVYFD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |