C12H12FNO — CID 135193068
7-fluoro-3,5a,9a,10-tetrahydro-2H-phenoxazine (PubChem CID 135193068) has the molecular formula C12H12FNO and a molecular weight of 205.23 g/mol. Its IUPAC name is 7-fluoro-3,5a,9a,10-tetrahydro-2H-phenoxazine.
| Compound Name | 7-fluoro-3,5a,9a,10-tetrahydro-2H-phenoxazine |
|---|---|
| PubChem CID | 135193068 |
| Molecular Formula | C12H12FNO |
| Molecular Weight | 205.23 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 7-fluoro-3,5a,9a,10-tetrahydro-2H-phenoxazine |
| SMILES | FC1=CC2OC3=CCCC=C3NC2C=C1 |
| InChI | InChI=1S/C12H12FNO/c13-8-5-6-10-12(7-8)15-11-4-2-1-3-9(11)14-10/h3-7,10,12,14H,1-2H2 |
| InChIKey | FEEFFVRDFAZFEY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |