About N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine
N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine (PubChem CID 135193102) has the molecular formula C12H14FN
and a molecular weight of 191.25 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine |
| PubChem CID | 135193102 |
| Molecular Formula | C12H14FN |
| Molecular Weight | 191.25 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine |
| SMILES | FC1=CCC(NC2=CCCC=C2)C=C1 |
| InChI | InChI=1S/C12H14FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h2,4-8,12,14H,1,3,9H2 |
| InChIKey | KAXWNTNJYCMNOM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine (CID 135193102) is N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine is FC1=CCC(NC2=CCCC=C2)C=C1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine?
The InChIKey is KAXWNTNJYCMNOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FN/c13-10-6-8-12(9-7-10)14-11-4-2-1-3-5-11/h2,4-8,12,14H,1,3,9H2.
What are the key properties of N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine?
N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine has a molecular weight of 191.25 g/mol, XLogP of 2.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-4-fluorocyclohexa-2,4-dien-1-amine is sourced from PubChem (CID 135193102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).