C13H13F2N — CID 135193106
2,7-difluoro-2,3,8a,9,10,10a-hexahydroacridine (PubChem CID 135193106) has the molecular formula C13H13F2N and a molecular weight of 221.25 g/mol. Its IUPAC name is 2,7-difluoro-2,3,8a,9,10,10a-hexahydroacridine.
| Compound Name | 2,7-difluoro-2,3,8a,9,10,10a-hexahydroacridine |
|---|---|
| PubChem CID | 135193106 |
| Molecular Formula | C13H13F2N |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2,7-difluoro-2,3,8a,9,10,10a-hexahydroacridine |
| SMILES | FC1=CC2CC3=CC(F)CC=C3NC2C=C1 |
| InChI | InChI=1S/C13H13F2N/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)16-12/h1,3-4,6-8,11-12,16H,2,5H2 |
| InChIKey | XZLJJDBGMRETBY-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |