About 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol
2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol (PubChem CID 135193692) has the molecular formula C16H9N3O2
and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol |
| PubChem CID | 135193692 |
| Molecular Formula | C16H9N3O2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol |
| SMILES | C#CC#COc1ccc(O)c(-n2nc3ccccc3n2)c1 |
| InChI | InChI=1S/C16H9N3O2/c1-2-3-10-21-12-8-9-16(20)15(11-12)19-17-13-6-4-5-7-14(13)18-19/h1,4-9,11,20H |
| InChIKey | FPVDDAFAAJIMLP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol?
The IUPAC name of 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol (CID 135193692) is 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol.
What is the SMILES notation for 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol?
The canonical SMILES for 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol is C#CC#COc1ccc(O)c(-n2nc3ccccc3n2)c1.
What is the InChIKey of 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol?
The InChIKey is FPVDDAFAAJIMLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9N3O2/c1-2-3-10-21-12-8-9-16(20)15(11-12)19-17-13-6-4-5-7-14(13)18-19/h1,4-9,11,20H.
What are the key properties of 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol?
2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol has a molecular weight of 275.27 g/mol, XLogP of 2.10, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-2-yl)-4-buta-1,3-diynoxyphenol is sourced from PubChem (CID 135193692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).