C19H12O4 — CID 135193860
16-methyl-5,7,21-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15,17,19-octaen-14-one (PubChem CID 135193860) has the molecular formula C19H12O4 and a molecular weight of 304.30 g/mol. Its IUPAC name is 16-methyl-5,7,21-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15,17,19-octaen-14-one.
| Compound Name | 16-methyl-5,7,21-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15,17,19-octaen-14-one |
|---|---|
| PubChem CID | 135193860 |
| Molecular Formula | C19H12O4 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 16-methyl-5,7,21-trioxapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,11,15,17,19-octaen-14-one |
| SMILES | Cc1cccc2oc3c(ccc4cc5c(cc43)OCO5)c(=O)c12 |
| InChI | InChI=1S/C19H12O4/c1-10-3-2-4-14-17(10)18(20)12-6-5-11-7-15-16(22-9-21-15)8-13(11)19(12)23-14/h2-8H,9H2,1H3 |
| InChIKey | WAYIBXRYUVZHGS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|