C10H14N2O5S — CID 135193885
(2Z)-2-(1,3-dihydroxy-2-methylpropan-2-yl)oxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid (PubChem CID 135193885) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is (2Z)-2-(1,3-dihydroxy-2-methylpropan-2-yl)oxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid.
| Compound Name | (2Z)-2-(1,3-dihydroxy-2-methylpropan-2-yl)oxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 135193885 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | (2Z)-2-(1,3-dihydroxy-2-methylpropan-2-yl)oxyimino-2-(2-methyl-1,3-thiazol-4-yl)acetic acid |
| SMILES | Cc1nc(/C(=N/OC(C)(CO)CO)C(=O)O)cs1 |
| InChI | InChI=1S/C10H14N2O5S/c1-6-11-7(3-18-6)8(9(15)16)12-17-10(2,4-13)5-14/h3,13-14H,4-5H2,1-2H3,(H,15,16)/b12-8- |
| InChIKey | GXXYBHSJQZUWJM-WQLSENKSSA-N |
| XLogP | 0.00 |
| TPSA | 112.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|