C28H32F3N5O2 — CID 135194014
2-ethyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 135194014) has the molecular formula C28H32F3N5O2 and a molecular weight of 527.59 g/mol. Its IUPAC name is 2-ethyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | 2-ethyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 135194014 |
| Molecular Formula | C28H32F3N5O2 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 527.25 |
| IUPAC Name | 2-ethyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-5,6,7,8-tetrahydroimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | CCc1nc2n(c1C(=O)NCc1ccc(N3CCN(c4ccc(OC(F)(F)F)cc4)CC3)cc1)CCCC2 |
| InChI | InChI=1S/C28H32F3N5O2/c1-2-24-26(36-14-4-3-5-25(36)33-24)27(37)32-19-20-6-8-21(9-7-20)34-15-17-35(18-16-34)22-10-12-23(13-11-22)38-28(29,30)31/h6-13H,2-5,14-19H2,1H3,(H,32,37) |
| InChIKey | GODFBBWLFJMTFL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|