C28H33F3N6O2 — CID 135194047
2-ethyl-7-methyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide (PubChem CID 135194047) has the molecular formula C28H33F3N6O2 and a molecular weight of 542.61 g/mol. Its IUPAC name is 2-ethyl-7-methyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide.
| Compound Name | 2-ethyl-7-methyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
|---|---|
| PubChem CID | 135194047 |
| Molecular Formula | C28H33F3N6O2 |
| Molecular Weight | 542.61 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | 2-ethyl-7-methyl-N-[[4-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]phenyl]methyl]-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-3-carboxamide |
| SMILES | CCc1nc2n(c1C(=O)NCc1ccc(N3CCN(c4ccc(OC(F)(F)F)cc4)CC3)cc1)CCN(C)C2 |
| InChI | InChI=1S/C28H33F3N6O2/c1-3-24-26(37-17-12-34(2)19-25(37)33-24)27(38)32-18-20-4-6-21(7-5-20)35-13-15-36(16-14-35)22-8-10-23(11-9-22)39-28(29,30)31/h4-11H,3,12-19H2,1-2H3,(H,32,38) |
| InChIKey | QKIXCDGSTPHFBR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 65.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.61 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|