C13H24O — CID 135194510
6,6-dimethyl-3,4-di(propan-2-yl)-2,5-dihydropyran (PubChem CID 135194510) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is 6,6-dimethyl-3,4-di(propan-2-yl)-2,5-dihydropyran.
| Compound Name | 6,6-dimethyl-3,4-di(propan-2-yl)-2,5-dihydropyran |
|---|---|
| PubChem CID | 135194510 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 6,6-dimethyl-3,4-di(propan-2-yl)-2,5-dihydropyran |
| SMILES | CC(C)C1=C(C(C)C)CC(C)(C)OC1 |
| InChI | InChI=1S/C13H24O/c1-9(2)11-7-13(5,6)14-8-12(11)10(3)4/h9-10H,7-8H2,1-6H3 |
| InChIKey | QTXIYXXSBFXWKH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|