C23H30F3N3O — CID 135194579
2-methyl-3-(3-pyrrolidin-1-ylpropoxy)-N-(2,2,2-trifluoroethyl)-7,8,9,10-tetrahydrophenanthridin-6-amine (PubChem CID 135194579) has the molecular formula C23H30F3N3O and a molecular weight of 421.51 g/mol. Its IUPAC name is 2-methyl-3-(3-pyrrolidin-1-ylpropoxy)-N-(2,2,2-trifluoroethyl)-7,8,9,10-tetrahydrophenanthridin-6-amine.
| Compound Name | 2-methyl-3-(3-pyrrolidin-1-ylpropoxy)-N-(2,2,2-trifluoroethyl)-7,8,9,10-tetrahydrophenanthridin-6-amine |
|---|---|
| PubChem CID | 135194579 |
| Molecular Formula | C23H30F3N3O |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-methyl-3-(3-pyrrolidin-1-ylpropoxy)-N-(2,2,2-trifluoroethyl)-7,8,9,10-tetrahydrophenanthridin-6-amine |
| SMILES | Cc1cc2c3c(c(NCC(F)(F)F)nc2cc1OCCCN1CCCC1)CCCC3 |
| InChI | InChI=1S/C23H30F3N3O/c1-16-13-19-17-7-2-3-8-18(17)22(27-15-23(24,25)26)28-20(19)14-21(16)30-12-6-11-29-9-4-5-10-29/h13-14H,2-12,15H2,1H3,(H,27,28) |
| InChIKey | IZASDAJFZYBGJY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|