C21H29NO3 — CID 135194583
(4'aS,5'S)-5'-methyl-8'a-phenyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydroisoquinoline]-1'-one (PubChem CID 135194583) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is (4'aS,5'S)-5'-methyl-8'a-phenyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydroisoquinoline]-1'-one.
| Compound Name | (4'aS,5'S)-5'-methyl-8'a-phenyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydroisoquinoline]-1'-one |
|---|---|
| PubChem CID | 135194583 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | (4'aS,5'S)-5'-methyl-8'a-phenyl-2'-propan-2-ylspiro[1,3-dioxolane-2,6'-3,4,4a,5,7,8-hexahydroisoquinoline]-1'-one |
| SMILES | CC(C)N1CC[C@H]2[C@H](C)C3(CCC2(c2ccccc2)C1=O)OCCO3 |
| InChI | InChI=1S/C21H29NO3/c1-15(2)22-12-9-18-16(3)21(24-13-14-25-21)11-10-20(18,19(22)23)17-7-5-4-6-8-17/h4-8,15-16,18H,9-14H2,1-3H3/t16-,18-,20?/m0/s1 |
| InChIKey | CAUOYUFHSVNEDN-WWKKGYIRSA-N |
| XLogP | 3.35 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |