C14H20N2O2 — CID 135194852
2,5,5,8a-tetramethyl-3,6-dioxo-4,4a,7,8-tetrahydro-1H-isoquinoline-7-carbonitrile (PubChem CID 135194852) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 2,5,5,8a-tetramethyl-3,6-dioxo-4,4a,7,8-tetrahydro-1H-isoquinoline-7-carbonitrile.
| Compound Name | 2,5,5,8a-tetramethyl-3,6-dioxo-4,4a,7,8-tetrahydro-1H-isoquinoline-7-carbonitrile |
|---|---|
| PubChem CID | 135194852 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2,5,5,8a-tetramethyl-3,6-dioxo-4,4a,7,8-tetrahydro-1H-isoquinoline-7-carbonitrile |
| SMILES | CN1CC2(C)CC(C#N)C(=O)C(C)(C)C2CC1=O |
| InChI | InChI=1S/C14H20N2O2/c1-13(2)10-5-11(17)16(4)8-14(10,3)6-9(7-15)12(13)18/h9-10H,5-6,8H2,1-4H3 |
| InChIKey | ACDXXKNCWIVPFJ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyano_keto_A(2)', 'substructure': 'N/A'} |
|---|