About [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate
[(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate (PubChem CID 135195222) has the molecular formula C17H24FNO2
and a molecular weight of 293.38 g/mol. Its IUPAC name is [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 135195222 |
| Molecular Formula | C17H24FNO2 |
| Molecular Weight | 293.38 g/mol |
| Exact Mass | 293.18 |
| IUPAC Name | [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate |
| SMILES | Cc1cc(F)ccc1[C@@H](C1CCC1)[C@H](C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C17H24FNO2/c1-10-9-14(18)7-8-15(10)16(13-5-4-6-13)12(3)21-17(20)11(2)19/h7-9,11-13,16H,4-6,19H2,1-3H3/t11-,12-,16+/m0/s1 |
| InChIKey | JZMUQLUEIXWVRZ-MQIPJXDCSA-N |
| XLogP | 3.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate (CID 135195222) is [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate is Cc1cc(F)ccc1[C@@H](C1CCC1)[C@H](C)OC(=O)[C@H](C)N.
What is the InChIKey of [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is JZMUQLUEIXWVRZ-MQIPJXDCSA-N. The full InChI is InChI=1S/C17H24FNO2/c1-10-9-14(18)7-8-15(10)16(13-5-4-6-13)12(3)21-17(20)11(2)19/h7-9,11-13,16H,4-6,19H2,1-3H3/t11-,12-,16+/m0/s1.
What are the key properties of [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate?
[(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 293.38 g/mol, XLogP of 3.30, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-1-cyclobutyl-1-(4-fluoro-2-methylphenyl)propan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 135195222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).