About [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate
[(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate (PubChem CID 135195225) has the molecular formula C17H26FNO2
and a molecular weight of 295.40 g/mol. Its IUPAC name is [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 135195225 |
| Molecular Formula | C17H26FNO2 |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate |
| SMILES | CCC(C)[C@@H](c1ccc(F)cc1C)[C@H](C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C17H26FNO2/c1-6-10(2)16(13(5)21-17(20)12(4)19)15-8-7-14(18)9-11(15)3/h7-10,12-13,16H,6,19H2,1-5H3/t10?,12-,13-,16+/m0/s1 |
| InChIKey | QZZDOSFJOFVIOO-PLPMPJEISA-N |
| XLogP | 3.54 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate (CID 135195225) is [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate is CCC(C)[C@@H](c1ccc(F)cc1C)[C@H](C)OC(=O)[C@H](C)N.
What is the InChIKey of [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is QZZDOSFJOFVIOO-PLPMPJEISA-N. The full InChI is InChI=1S/C17H26FNO2/c1-6-10(2)16(13(5)21-17(20)12(4)19)15-8-7-14(18)9-11(15)3/h7-10,12-13,16H,6,19H2,1-5H3/t10?,12-,13-,16+/m0/s1.
What are the key properties of [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate?
[(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 295.40 g/mol, XLogP of 3.54, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-(4-fluoro-2-methylphenyl)-4-methylhexan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 135195225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).