About [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate
[(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate (PubChem CID 135195267) has the molecular formula C16H24FNO2
and a molecular weight of 281.37 g/mol. Its IUPAC name is [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate.
Molecular Properties
| Compound Name | [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate |
| PubChem CID | 135195267 |
| Molecular Formula | C16H24FNO2 |
| Molecular Weight | 281.37 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate |
| SMILES | Cc1c(F)cccc1[C@H](C(C)C)[C@H](C)OC(=O)[C@H](C)N |
| InChI | InChI=1S/C16H24FNO2/c1-9(2)15(12(5)20-16(19)11(4)18)13-7-6-8-14(17)10(13)3/h6-9,11-12,15H,18H2,1-5H3/t11-,12-,15+/m0/s1 |
| InChIKey | RQXAXRCFWOXKTA-SLEUVZQESA-N |
| XLogP | 3.15 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.37 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate?
The IUPAC name of [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate (CID 135195267) is [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate.
What is the SMILES notation for [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate?
The canonical SMILES for [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate is Cc1c(F)cccc1[C@H](C(C)C)[C@H](C)OC(=O)[C@H](C)N.
What is the InChIKey of [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate?
The InChIKey is RQXAXRCFWOXKTA-SLEUVZQESA-N. The full InChI is InChI=1S/C16H24FNO2/c1-9(2)15(12(5)20-16(19)11(4)18)13-7-6-8-14(17)10(13)3/h6-9,11-12,15H,18H2,1-5H3/t11-,12-,15+/m0/s1.
What are the key properties of [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate?
[(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate has a molecular weight of 281.37 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,3S)-3-(3-fluoro-2-methylphenyl)-4-methylpentan-2-yl] (2S)-2-aminopropanoate is sourced from PubChem (CID 135195267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).