About 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one
4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one (PubChem CID 135195320) has the molecular formula C10H14F6OS
and a molecular weight of 296.28 g/mol. Its IUPAC name is 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one.
Molecular Properties
| Compound Name | 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one |
| PubChem CID | 135195320 |
| Molecular Formula | C10H14F6OS |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one |
| SMILES | CC(=O)CCSCC(CCC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H14F6OS/c1-7(17)3-5-18-6-8(10(14,15)16)2-4-9(11,12)13/h8H,2-6H2,1H3 |
| InChIKey | SIZKYHSRGCUGOC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one?
The IUPAC name of 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one (CID 135195320) is 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one.
What is the SMILES notation for 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one?
The canonical SMILES for 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one is CC(=O)CCSCC(CCC(F)(F)F)C(F)(F)F.
What is the InChIKey of 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one?
The InChIKey is SIZKYHSRGCUGOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F6OS/c1-7(17)3-5-18-6-8(10(14,15)16)2-4-9(11,12)13/h8H,2-6H2,1H3.
What are the key properties of 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one?
4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one has a molecular weight of 296.28 g/mol, XLogP of 4.22, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5,5,5-trifluoro-2-(trifluoromethyl)pentyl]sulfanylbutan-2-one is sourced from PubChem (CID 135195320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).