About 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine
6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine (PubChem CID 135195528) has the molecular formula C14H13ClFN5O
and a molecular weight of 321.74 g/mol. Its IUPAC name is 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine.
Molecular Properties
| Compound Name | 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine |
| PubChem CID | 135195528 |
| Molecular Formula | C14H13ClFN5O |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine |
| SMILES | COC1C=C(c2cc(Cl)ccc2-n2cc(CF)nn2)NC=N1 |
| InChI | InChI=1S/C14H13ClFN5O/c1-22-14-5-12(17-8-18-14)11-4-9(15)2-3-13(11)21-7-10(6-16)19-20-21/h2-5,7-8,14H,6H2,1H3,(H,17,18) |
| InChIKey | OJFHIBNODVZVLM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine?
The IUPAC name of 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine (CID 135195528) is 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine.
What is the SMILES notation for 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine?
The canonical SMILES for 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine is COC1C=C(c2cc(Cl)ccc2-n2cc(CF)nn2)NC=N1.
What is the InChIKey of 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine?
The InChIKey is OJFHIBNODVZVLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClFN5O/c1-22-14-5-12(17-8-18-14)11-4-9(15)2-3-13(11)21-7-10(6-16)19-20-21/h2-5,7-8,14H,6H2,1H3,(H,17,18).
What are the key properties of 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine?
6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine has a molecular weight of 321.74 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-chloro-2-[4-(fluoromethyl)triazol-1-yl]phenyl]-4-methoxy-1,4-dihydropyrimidine is sourced from PubChem (CID 135195528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).