About 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine
6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine (PubChem CID 135195567) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 135195567 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine |
| SMILES | CC1=CC2N=CN(C(C)C)C2N=C1 |
| InChI | InChI=1S/C10H15N3/c1-7(2)13-6-12-9-4-8(3)5-11-10(9)13/h4-7,9-10H,1-3H3 |
| InChIKey | WZZSRKQBVZMGEO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine (CID 135195567) is 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine is CC1=CC2N=CN(C(C)C)C2N=C1.
What is the InChIKey of 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The InChIKey is WZZSRKQBVZMGEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3/c1-7(2)13-6-12-9-4-8(3)5-11-10(9)13/h4-7,9-10H,1-3H3.
What are the key properties of 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine?
6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine has a molecular weight of 177.25 g/mol, XLogP of 1.46, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-3-propan-2-yl-3a,7a-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 135195567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).