C19H26O3 — CID 135195906
2-[(1E,3E,5E)-3,7-dimethylocta-1,3,5,7-tetraenyl]-5-hydroxy-3,3-dimethylcyclohexene-1-carboxylic acid (PubChem CID 135195906) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 2-[(1E,3E,5E)-3,7-dimethylocta-1,3,5,7-tetraenyl]-5-hydroxy-3,3-dimethylcyclohexene-1-carboxylic acid.
| Compound Name | 2-[(1E,3E,5E)-3,7-dimethylocta-1,3,5,7-tetraenyl]-5-hydroxy-3,3-dimethylcyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 135195906 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2-[(1E,3E,5E)-3,7-dimethylocta-1,3,5,7-tetraenyl]-5-hydroxy-3,3-dimethylcyclohexene-1-carboxylic acid |
| SMILES | C=C(C)/C=C/C=C(C)/C=C/C1=C(C(=O)O)CC(O)CC1(C)C |
| InChI | InChI=1S/C19H26O3/c1-13(2)7-6-8-14(3)9-10-17-16(18(21)22)11-15(20)12-19(17,4)5/h6-10,15,20H,1,11-12H2,2-5H3,(H,21,22)/b7-6+,10-9+,14-8+ |
| InChIKey | PWWGPFLDSTWKNR-YBKJGJTHSA-N |
| XLogP | 4.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|