C18H25NO — CID 135195918
8-hexoxy-3,4b,8a,9-tetrahydro-2H-carbazole (PubChem CID 135195918) has the molecular formula C18H25NO and a molecular weight of 271.40 g/mol. Its IUPAC name is 8-hexoxy-3,4b,8a,9-tetrahydro-2H-carbazole.
| Compound Name | 8-hexoxy-3,4b,8a,9-tetrahydro-2H-carbazole |
|---|---|
| PubChem CID | 135195918 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 8-hexoxy-3,4b,8a,9-tetrahydro-2H-carbazole |
| SMILES | CCCCCCOC1=CC=CC2C3=CCCC=C3NC12 |
| InChI | InChI=1S/C18H25NO/c1-2-3-4-7-13-20-17-12-8-10-15-14-9-5-6-11-16(14)19-18(15)17/h8-12,15,18-19H,2-7,13H2,1H3 |
| InChIKey | YXCJOLUNFAYNPB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|