C14H23NO — CID 135196032
[(3Z,5Z)-5-methylhepta-3,5-dien-2-yl] N,3-dimethylbut-3-enimidate (PubChem CID 135196032) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is [(3Z,5Z)-5-methylhepta-3,5-dien-2-yl] N,3-dimethylbut-3-enimidate.
| Compound Name | [(3Z,5Z)-5-methylhepta-3,5-dien-2-yl] N,3-dimethylbut-3-enimidate |
|---|---|
| PubChem CID | 135196032 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | [(3Z,5Z)-5-methylhepta-3,5-dien-2-yl] N,3-dimethylbut-3-enimidate |
| SMILES | C=C(C)C/C(=N\C)OC(C)/C=C\C(C)=C/C |
| InChI | InChI=1S/C14H23NO/c1-7-12(4)8-9-13(5)16-14(15-6)10-11(2)3/h7-9,13H,2,10H2,1,3-6H3/b9-8-,12-7-,15-14+ |
| InChIKey | LLSCIVVUGFHBEE-AZJNWMNPSA-N |
| XLogP | 3.91 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|