C10H14O3 — CID 135196152
(1R,3R,6S,8R,9S,10R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-one (PubChem CID 135196152) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (1R,3R,6S,8R,9S,10R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-one.
| Compound Name | (1R,3R,6S,8R,9S,10R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-one |
|---|---|
| PubChem CID | 135196152 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (1R,3R,6S,8R,9S,10R)-9,10-dimethyl-2,7-dioxatricyclo[4.3.1.03,8]decan-5-one |
| SMILES | C[C@@H]1[C@@H]2O[C@@H]3CC(=O)[C@H]1O[C@@H]3[C@H]2C |
| InChI | InChI=1S/C10H14O3/c1-4-8-5(2)10-7(12-8)3-6(11)9(4)13-10/h4-5,7-10H,3H2,1-2H3/t4-,5+,7-,8+,9+,10-/m1/s1 |
| InChIKey | KPJJESHSWQJWSY-HSIIFYQZSA-N |
| XLogP | 0.77 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |